1435-52-5
| Name | 1,4-DIBROMO-2-FLUOROBENZENE |
| CAS | 1435-52-5 |
| EINECS(EC#) | 629-432-3 |
| Molecular Formula | C6H3Br2F |
| MDL Number | MFCD00010603 |
| Molecular Weight | 253.89 |
| MOL File | 1435-52-5.mol |
Chemical Properties
| Appearance | white crystalline mass |
| Melting point | 33-36 °C (lit.) |
| Boiling point | 216 °C (lit.) |
| density | 2.0491 (rough estimate) |
| refractive index | 1.5770 (estimate) |
| Fp | 215 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to lump to clear liquid |
| color | White or Colorles to Yellow to Orange |
| Water Solubility | Insoluble in water. |
| FreezingPoint | 32.0 to 34.0 ℃ |
| BRN | 3236451 |
| InChI | InChI=1S/C6H3Br2F/c7-4-1-2-5(8)6(9)3-4/h1-3H |
| InChIKey | WNSNPGHNIJOOPM-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=C(Br)C=C1F |
| CAS DataBase Reference | 1435-52-5(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29039990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |