140-82-9
| Name | 6-Ethyl-3-oxa-6-azaoctanol |
| CAS | 140-82-9 |
| EINECS(EC#) | 205-436-7 |
| Molecular Formula | C8H19NO2 |
| MDL Number | MFCD00020604 |
| Molecular Weight | 161.24 |
| MOL File | 140-82-9.mol |
Chemical Properties
| Boiling point | 101°C 1mm |
| density | 0,94 g/cm3 |
| refractive index | 1.4470-1.4500 |
| Fp | 96°C |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | clear liquid |
| pka | 14.39±0.10(Predicted) |
| color | Colorless to Light orange to Yellow |
| InChI | InChI=1S/C8H19NO2/c1-3-9(4-2)5-7-11-8-6-10/h10H,3-8H2,1-2H3 |
| InChIKey | VKBVRNHODPFVHK-UHFFFAOYSA-N |
| SMILES | C(O)COCCN(CC)CC |
| CAS DataBase Reference | 140-82-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-(2-Diethylaminoethoxy)-ethanol(140-82-9) |
| EPA Substance Registry System | 140-82-9(EPA Substance) |
Safety Data
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Warning |
| Hazard statements | H320 |
| Precautionary statements | P264-P305+P351+P338+P337+P313 |
| Hazard Codes | C |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | WGK 3 |
| TSCA | TSCA listed |
| REACH Registrations | Active |
| HS Code | 2922500090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Dermal Eye Dam. 1 Skin Corr. 1B |
| Safety Profile | |
| Toxicity |