
139756-02-8
| Name | 4-Amino-1-methyl-3-propyl-5-pyrazolecarboxamide |
| CAS | 139756-02-8 |
| EINECS(EC#) | 604-160-8 |
| Molecular Formula | C8H14N4O |
| MDL Number | MFCD03458971 |
| Molecular Weight | 182.22 |
| MOL File | 139756-02-8.mol |
Chemical Properties
| Melting point | 98-101 °C(lit.) |
| Boiling point | 325.9±42.0 °C(Predicted) |
| density | 1.32±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform, Ethyl Acetate, Methanol |
| form | Solid |
| pka | 15.30±0.50(Predicted) |
| color | Off-White to Pale Beige |
| Usage | A potent hypolipidemic agent. A possible inhibitor of phosphodiesterase 1 |
| InChI | InChI=1S/C8H14N4O/c1-3-4-5-6(9)7(8(10)13)12(2)11-5/h3-4,9H2,1-2H3,(H2,10,13) |
| InChIKey | PZMXDLWWQHYXGY-UHFFFAOYSA-N |
| SMILES | N1(C)C(C(N)=O)=C(N)C(CCC)=N1 |
| CAS DataBase Reference | 139756-02-8(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 2933.19.4300 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
