
13534-99-1
| Name | 3-Bromo-2-pyridinamine |
| CAS | 13534-99-1 |
| EINECS(EC#) | 629-620-5 |
| Molecular Formula | C5H5BrN2 |
| MDL Number | MFCD03095187 |
| Molecular Weight | 173.01 |
| MOL File | 13534-99-1.mol |
Chemical Properties
| Appearance | grey to brown powder |
| Melting point | 63-67 °C |
| Boiling point | 232.0±20.0 °C(Predicted) |
| density | 1.6065 (rough estimate) |
| vapor pressure | 0.83-1.8Pa at 20-25℃ |
| refractive index | 1.5182 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | Powder |
| pka | 4.14±0.36(Predicted) |
| color | Gray to brown |
| BRN | 109867 |
| InChI | InChI=1S/C5H5BrN2/c6-4-2-1-3-8-5(4)7/h1-3H,(H2,7,8) |
| InChIKey | RBCARPJOEUEZLS-UHFFFAOYSA-N |
| SMILES | C1(N)=NC=CC=C1Br |
| LogP | 1.5 at 20℃ and pH7 |
| CAS DataBase Reference | 13534-99-1(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| REACH Registrations | Active |
| HazardClass | IRRITANT |
| PackingGroup | II |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
