
13466-38-1
| Name | 2-Hydroxy-5-bromopyridine |
| CAS | 13466-38-1 |
| EINECS(EC#) | 629-311-5 |
| Molecular Formula | C5H4BrNO |
| MDL Number | MFCD00234042 |
| Molecular Weight | 174 |
| MOL File | 13466-38-1.mol |
Chemical Properties
| Appearance | off-white to yellow-brown crystalline powder |
| Melting point | 180-183 °C(lit.) |
| Boiling point | 305.9±42.0 °C(Predicted) |
| density | 1.776±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | Crystalline Powder |
| pka | 9.96±0.10(Predicted) |
| color | Off-white to yellow-brown |
| BRN | 108751 |
| InChI | InChI=1S/C5H4BrNO/c6-4-1-2-5(8)7-3-4/h1-3H,(H,7,8) |
| InChIKey | NDMZZQRNZFWMEZ-UHFFFAOYSA-N |
| SMILES | C1(=O)NC=C(Br)C=C1 |
| CAS DataBase Reference | 13466-38-1(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |

