131-53-3
| Name | 2,2'-Dihydroxy-4-methoxybenzophenone |
| CAS | 131-53-3 |
| EINECS(EC#) | 205-026-8 |
| Molecular Formula | C14H12O4 |
| MDL Number | MFCD00002218 |
| Molecular Weight | 244.24 |
| MOL File | 131-53-3.mol |
Chemical Properties
| Appearance | yellow powder |
| Melting point | 73-75 °C(lit.) |
| Boiling point | 170-175 °C1 mm Hg(lit.) |
| density | 1.2379 (rough estimate) |
| vapor pressure | 0-0Pa at 20-25℃ |
| refractive index | 1.5389 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | neat |
| pka | 7.11±0.35(Predicted) |
| color | Off-White to Yellow |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Merck | 3303 |
| Cosmetics Ingredients Functions | UV ABSORBER |
| Cosmetic Ingredient Review (CIR) | 2,2'-Dihydroxy-4-methoxybenzophenone (131-53-3) |
| InChI | 1S/C14H12O4/c1-18-9-6-7-11(13(16)8-9)14(17)10-4-2-3-5-12(10)15/h2-8,15-16H,1H3 |
| InChIKey | MEZZCSHVIGVWFI-UHFFFAOYSA-N |
| SMILES | COc1ccc(c(O)c1)C(=O)c2ccccc2O |
| LogP | 2.33 at 23.5℃ |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | DJ1049500 |
| TSCA | TSCA listed |
| REACH Registrations | Active |
| HS Code | 29145090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 131-53-3(Hazardous Substances Data) |