128495-46-5
| Name | 4-FLUORO-3-METHOXYBENZALDEHYDE |
| CAS | 128495-46-5 |
| EINECS(EC#) | 603-276-6 |
| Molecular Formula | C8H7FO2 |
| MDL Number | MFCD00143320 |
| Molecular Weight | 154.14 |
| MOL File | 128495-46-5.mol |
Chemical Properties
| Melting point | 58-62 °C(lit.) |
| Boiling point | 93 °C(Press: 4.5 Torr) |
| density | 1.192±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Light yellow |
| Sensitive | Air Sensitive |
| BRN | 5178063 |
| InChI | InChI=1S/C8H7FO2/c1-11-8-4-6(5-10)2-3-7(8)9/h2-5H,1H3 |
| InChIKey | NALVGTOMKSKFFV-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC=C(F)C(OC)=C1 |
| CAS DataBase Reference | 128495-46-5(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 2 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29124990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
