
126213-50-1
| Name | 3,4-Ethylenedioxythiophene |
| CAS | 126213-50-1 |
| EINECS(EC#) | 1806241-263-5 |
| Molecular Formula | C6H6O2S |
| MDL Number | MFCD02093622 |
| Molecular Weight | 142.18 |
| MOL File | 126213-50-1.mol |
Chemical Properties
| Melting point | 10 °C |
| Boiling point | 193 °C (lit.) |
| density | 1.331 g/mL at 25 °C(lit.) |
| vapor pressure | 11.9Pa at 25℃ |
| refractive index | n |
| Fp | 230 °F |
| storage temp. | 2-8°C |
| form | clear liquid |
| color | Colorless to Yellow |
| Water Solubility | Immsicible with water. Miscible with alcohol and ether. |
| InChI | InChI=1S/C6H6O2S/c1-2-8-6-4-9-3-5(6)7-1/h3-4H,1-2H2 |
| InChIKey | GKWLILHTTGWKLQ-UHFFFAOYSA-N |
| SMILES | O1CCOC2=CSC=C12 |
| LogP | 1.976 at 25℃ and pH7.1 |
| CAS DataBase Reference | 126213-50-1(CAS DataBase Reference) |
| EPA Substance Registry System | 126213-50-1(EPA Substance) |
Safety Data
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H302-H311-H319 |
| Precautionary statements | P264-P270-P280-P301+P312-P302+P352+P312-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2810 6.1/PG 3 |
| WGK Germany | 2 |
| TSCA | Yes |
| REACH Registrations | Inactive |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29349900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 4 Oral Eye Irrit. 2 |
