1259-35-4
| Name | TRIS(PENTAFLUOROPHENYL)PHOSPHINE |
| CAS | 1259-35-4 |
| EINECS(EC#) | 215-021-2 |
| Molecular Formula | C18F15P |
| MDL Number | MFCD00079654 |
| Molecular Weight | 532.14 |
| MOL File | 1259-35-4.mol |
Chemical Properties
| Appearance | white to light yellow crystal powde |
| Melting point | 108-110 °C (lit.) |
| Boiling point | 343.4±42.0 °C(Predicted) |
| Fp | Not applicable |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Liquid |
| color | Clear colorless to yellow |
| Water Solubility | Insoluble in water. |
| BRN | 773243 |
| InChI | InChI=1S/C18F15P/c19-1-4(22)10(28)16(11(29)5(1)23)34(17-12(30)6(24)2(20)7(25)13(17)31)18-14(32)8(26)3(21)9(27)15(18)33 |
| InChIKey | FQLSDFNKTNBQLC-UHFFFAOYSA-N |
| SMILES | P(C1=C(F)C(F)=C(F)C(F)=C1F)(C1=C(F)C(F)=C(F)C(F)=C1F)C1=C(F)C(F)=C(F)C(F)=C1F |
| CAS DataBase Reference | 1259-35-4(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| F | 10 |
| Hazard Note | Irritant |
| TSCA | No |
| HS Code | 29319019 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |