
18437-78-0
| Name | TRIS(4-FLUOROPHENYL)PHOSPHINE |
| CAS | 18437-78-0 |
| Molecular Formula | C18H12F3P |
| MDL Number | MFCD00013553 |
| Molecular Weight | 316.26 |
| MOL File | 18437-78-0.mol |
Chemical Properties
| Appearance | white to light yellow crystal powde |
| Melting point | 79-83 °C(lit.) |
| Boiling point | 160°C/0.1mmHg(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Crystalline Powder |
| color | White to very slightly yellow |
| Water Solubility | Insoluble in water. |
| Sensitive | Air Sensitive |
| BRN | 919838 |
| InChI | InChI=1S/C18H12F3P/c19-13-1-7-16(8-2-13)22(17-9-3-14(20)4-10-17)18-11-5-15(21)6-12-18/h1-12H |
| InChIKey | GEPJPYNDFSOARB-UHFFFAOYSA-N |
| SMILES | P(C1=CC=C(F)C=C1)(C1=CC=C(F)C=C1)C1=CC=C(F)C=C1 |
| CAS DataBase Reference | 18437-78-0(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29319090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
