1038-95-5
| Name | TRI-P-TOLYLPHOSPHINE |
| CAS | 1038-95-5 |
| EINECS(EC#) | 213-863-5 |
| Molecular Formula | C21H21P |
| MDL Number | MFCD00008542 |
| Molecular Weight | 304.37 |
| MOL File | 1038-95-5.mol |
Chemical Properties
| Appearance | white to light yellow crystal powde |
| Melting point | 144-148 °C(lit.) |
| Boiling point | 399.8±41.0 °C(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Crystals or Crystalline Powder |
| color | White to light yellow |
| Water Solubility | Insoluble in water. |
| Sensitive | Air Sensitive |
| Detection Methods | HPLC,NMR |
| BRN | 651045 |
| InChI | InChI=1S/C21H21P/c1-16-4-10-19(11-5-16)22(20-12-6-17(2)7-13-20)21-14-8-18(3)9-15-21/h4-15H,1-3H3 |
| InChIKey | WXAZIUYTQHYBFW-UHFFFAOYSA-N |
| SMILES | P(C1=CC=C(C)C=C1)(C1=CC=C(C)C=C1)C1=CC=C(C)C=C1 |
| CAS DataBase Reference | 1038-95-5(CAS DataBase Reference) |
| Storage Precautions | Air sensitive |
| EPA Substance Registry System | Phosphine, tris(4-methylphenyl)- (1038-95-5) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | SZ3880000 |
| F | 10-23 |
| TSCA | Yes |
| HS Code | 29319090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |