
1217462-49-1
| Name | Aflatoxin G2-<sup>13</sup>C<sub>17</sub> |
| CAS | 1217462-49-1 |
| EINECS(EC#) | 200-835-2 |
| Molecular Formula | C17H14O7 |
| MDL Number | MFCD14636316 |
| Molecular Weight | 347.442 |
| MOL File | 1217462-49-1.mol |
Chemical Properties
| density | 1.556±0.10 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) |
| Fp | 2℃ |
| storage temp. | -20°C |
| solubility | Acetonitrile: soluble |
| form | Liquid |
| color | Colorless to light yellow |
| Major Application | cleaning products cosmetics food and beverages personal care |
| InChIKey | WPCVRWVBBXIRMA-DENWKYDXSA-N |
| SMILES | [13CH3]O[13c]1[13cH][13c]2O[13C@H]3O[13CH2][13CH2][13C@H]3[13c]2[13c]4O[13C](=O)[13C]5=[13C]([13CH2][13CH2]O[13C]5=O)[13c]14 |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H302+H312+H332-H319 |
| Precautionary statements | P210-P280-P305+P351+P338 |
| Hazard Codes | F,Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1648 3 / PGII |
| WGK Germany | 2 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 2 |

