1075-89-4
| Name | 3,3-Tetramethyleneglutarimide |
| CAS | 1075-89-4 |
| EINECS(EC#) | 427-770-4 |
| Molecular Formula | C9H13NO2 |
| MDL Number | MFCD00023871 |
| Molecular Weight | 167.21 |
| MOL File | 1075-89-4.mol |
Chemical Properties
| Appearance | white to off-white crystalline powder |
| Melting point | 153-155 °C |
| Boiling point | 295.79°C (rough estimate) |
| density | 1.1222 (rough estimate) |
| refractive index | 1.4760 (estimate) |
| storage temp. | Poison room |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | powder to crystal |
| pka | 11.71±0.20(Predicted) |
| color | White to Almost white |
| BRN | 383702 |
| Major Application | pharmaceutical (small molecule) |
| InChI | InChI=1S/C9H13NO2/c11-7-5-9(3-1-2-4-9)6-8(12)10-7/h1-6H2,(H,10,11,12) |
| InChIKey | YRTHJMQKDCXPAY-UHFFFAOYSA-N |
| SMILES | C1C2(CC(=O)NC(=O)C2)CCC1 |
| CAS DataBase Reference | 1075-89-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,1-Cyclopentanediacetimide(1075-89-4) |
Safety Data
| Symbol(GHS) |   GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301-H411 |
| Precautionary statements | P264-P270-P273-P301+P310-P391-P405 |
| Hazard Codes | T+ |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | WGK 3 |
| REACH Registrations | Active |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29251995 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Chronic 2 |
