10493-44-4
| Name | 4-Bromo-1,1,2-trifluoro-1-butene |
| CAS | 10493-44-4 |
| EINECS(EC#) | 234-019-2 |
| Molecular Formula | C4H4BrF3 |
| MDL Number | MFCD00039274 |
| Molecular Weight | 188.97 |
| MOL File | 10493-44-4.mol |
Chemical Properties
| Appearance | clear colorless to brown-yellow liquid |
| Boiling point | 95-98 °C (lit.) |
| density | 1.639 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 63 °F |
| storage temp. | Flammables area |
| form | liquid |
| color | Clear, faint lime |
| Water Solubility | Not miscible or difficult to mix in water. |
| Sensitive | Light Sensitive |
| BRN | 1840755 |
| InChI | InChI=1S/C4H4BrF3/c5-2-1-3(6)4(7)8/h1-2H2 |
| InChIKey | GQCQMFYIFUDARF-UHFFFAOYSA-N |
| SMILES | C(/F)(\F)=C(/F)\CCBr |
| CAS DataBase Reference | 10493-44-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Bromo-1,1,2-trifluorobutene-1(10493-44-4) |
Safety Data
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H302+H312+H332-H319-H335 |
| Precautionary statements | P210-P280-P301+P312-P303+P361+P353-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | F,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1993 3/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Highly Flammable/Irritant |
| HazardClass | 3 |
| PackingGroup | II |
| HS Code | 29037990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 2 STOT SE 3 |