
101-05-3
| Name | ANILAZINE |
| CAS | 101-05-3 |
| EINECS(EC#) | 202-910-5 |
| Molecular Formula | C9H5Cl3N4 |
| MDL Number | MFCD00041815 |
| Molecular Weight | 275.52 |
| MOL File | 101-05-3.mol |
Chemical Properties
| Appearance | white to light brown crystals or powder |
| Melting point | 159-160℃ |
| Boiling point | 425.99°C (rough estimate) |
| density | 1.611 |
| refractive index | 1.6000 (estimate) |
| storage temp. | 0-6°C |
| form | neat |
| pka | 0.43±0.10(Predicted) |
| Stability: | Stable. Incompatible with oils and alkalies. May corrode some types of metal and alloy. |
| Water Solubility | 10mg/L(temperature not stated) |
| Merck | 13,659 |
| BRN | 223133 |
| Henry's Law Constant | 3.5×104 mol/(m3Pa) at 25℃, HSDB (2015) |
| Exposure limits | The German Research Society’s recommended Maximum Allowable Concentration is 0.2 mg/m3. |
| Major Application | agriculture environmental |
| InChI | 1S/C9H5Cl3N4/c10-5-3-1-2-4-6(5)13-9-15-7(11)14-8(12)16-9/h1-4H,(H,13,14,15,16) |
| InChIKey | IMHBYKMAHXWHRP-UHFFFAOYSA-N |
| SMILES | Clc1nc(Cl)nc(Nc2ccccc2Cl)n1 |
| CAS DataBase Reference | 101-05-3(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xi,N |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN3077 9/PG 3 |
| WGK Germany | 3 |
| RTECS | XY7175000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Skin Irrit. 2 |
| Hazardous Substances Data | 101-05-3(Hazardous Substances Data) |
| Toxicity |