| Appearance |
Colorless liquid or solid. Miscible with acetone,
benzene, chloroform, dioxane, ethyl acetate,
ethanol, and xylene. Combustible. |
| Melting point |
26-28 °C
|
| Boiling point |
156 °C
|
| density |
1.11 g/mL at 30 °C
|
| vapor pressure |
1.3 hPa (100 °C) |
| refractive index |
1.5290 (estimate) |
| Fp |
>230 °F
|
| storage temp. |
Store at <= 20°C. |
| solubility |
0.3g/l |
| form |
Oil |
| pka |
2.04±0.10(Predicted) |
| color |
Colourless |
| Specific Gravity |
1.11 |
| Stability: |
Stable, but moisture-sensitive. Incompatible with acids, peroxides, strong oxidizing agents, copper, iron and its salts. |
| Water Solubility |
6g/L(20 ºC) |
| BRN |
235560 |
| Henry's Law Constant |
2.3×101 mol/(m3Pa) at 25℃, Zhang et al. (2010) |
| InChI |
1S/C12H15N3O3/c1-4-7-16-10-13-11(17-8-5-2)15-12(14-10)18-9-6-3/h4-6H,1-3,7-9H2 |
| InChIKey |
BJELTSYBAHKXRW-UHFFFAOYSA-N |
| SMILES |
C=CCOc1nc(OCC=C)nc(OCC=C)n1 |
| LogP |
3.51 at 20℃ |
| Uses |
Polymers as monomer and modifier, organic
intermediate.
|
| CAS DataBase Reference |
101-37-1(CAS DataBase Reference) |
| NIST Chemistry Reference |
2,4,6-Triallyloxy-1,3,5-triazine(101-37-1) |
| EPA Substance Registry System |
101-37-1(EPA Substance) |
