| Melting point |
167-168 °C |
| solubility |
H2O: storage of solutions for more than 8 hours at 4°C is not recommended.soluble |
| form |
solid |
| color |
light yellow |
| PH |
pH:9.0～11.0 (50g/l, 25℃) |
| Water Solubility |
H2O: soluble (storage of solutions for more than 8 hours at 4°C is not recommended.) |
| InChI |
1S/C10H16N2O2S.Na/c1-4-6(3)10(5-2)7(13)11-9(15)12-8(10)14;/h6H,4-5H2,1-3H3,(H2,11,12,13,14,15);/q;+1/p-1 |
| InChIKey |
SLZHLQUFNFXTHB-UHFFFAOYSA-M |
| SMILES |
[Na+].CCC(C)C1(CC)C([O-])=NC(=S)NC1=O |
| EPA Substance Registry System |
Thiobutabarbital sodium (947-08-0) |
