| Melting point |
176-180 °C(lit.) |
| Boiling point |
355.44°C (rough estimate) |
| alpha |
D20 +53 to +56° (c = 0.9 in dioxane) |
| Density |
1.0708 (rough estimate) |
| refractive index |
1.4800 (estimate) |
| storage temp. |
Sealed in dry,Room Temperature |
| solubility |
ethanol: 50 mg/mL, clear, colorless |
| form |
powder |
| pka |
10.27±0.60(Predicted) |
| color |
white with slight yellow |
| biological source |
synthetic (organic) |
| Water Solubility |
3.9mg/L(25 ºC) |
| Merck |
14,3704 |
| InChI |
1S/C18H24O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3,5,10,14-17,19-20H,2,4,6-9H2,1H3/t14-,15-,16+,17-,18+/m1/s1 |
| InChIKey |
VOXZDWNPVJITMN-SFFUCWETSA-N |
| SMILES |
[H][C@]12CC[C@]3(C)[C@H](O)CC[C@@]3([H])[C@]1([H])CCc4cc(O)ccc24 |
| CAS DataBase Reference |
57-91-0(CAS DataBase Reference) |
| NIST Chemistry Reference |
Estra-1,3,5(10)-triene-3,17alpha-diol(57-91-0) |
| EPA Substance Registry System |
Estra-1,3,5(10)-triene-3,17-diol, (17.alpha.)- (57-91-0) |
