| Melting point |
178-179 °C(lit.) |
| Boiling point |
355.44°C (rough estimate) |
| alpha |
D25 +76 to +83° (dioxane) |
| Density |
1.0708 (rough estimate) |
| refractive index |
80.4 ° (C=1, Dioxane) |
| Flash point |
2℃ |
| storage temp. |
room temp |
| solubility |
Practically insoluble in water, soluble in acetone, sparingly soluble in ethanol (96 per cent), slightly soluble in methylene chloride. |
| form |
powder |
| pka |
pKa 10.71±0.02(H2O(0.1% p-dioxane) t=25±0.1 I=0.03(KCl))(Approximate) |
| color |
White to off-white |
| biological source |
synthetic (organic) |
| Water Solubility |
Soluble in dimethyl sulfoxide, ethanol , water, phosphate buffer saline, dimethyl formamide, acetone, dioxane and alkali hydroxides. Slightly soluble in vegetable oils. |
| Merck |
14,3703 |
| BRN |
1914275 |
| Henry's Law Constant |
2.7×105 mol/(m3Pa) at 25℃, HSDB (2015) |
| BCS Class |
1 |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| Cosmetics Ingredients Functions |
SKIN CONDITIONING |
| InChI |
1S/C18H24O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3,5,10,14-17,19-20H,2,4,6-9H2,1H3/t14-,15-,16+,17+,18+/m1/s1 |
| InChIKey |
VOXZDWNPVJITMN-ZBRFXRBCSA-N |
| SMILES |
O[C@H]1CC[C@@]2([H])[C@]3([H])CCC4=CC(O)=CC=C4[C@@]3([H])CC[C@@]21C |
| CAS DataBase Reference |
50-28-2(CAS DataBase Reference) |
| NIST Chemistry Reference |
Estra-1,3,5(10)-triene-3,17beta-diol(50-28-2) |
| EPA Substance Registry System |
Estradiol (50-28-2) |