| Melting point |
94.5-950C |
| Boiling point |
475.43°C (rough estimate) |
| Density |
1.0779 (rough estimate) |
| refractive index |
1.6300 (estimate) |
| storage temp. |
Inert atmosphere,Room Temperature |
| solubility |
Soluble in DMSO (25 mg/ml) and Ethanol (>35 mg/mL) |
| form |
solid |
| pka |
10.2; also reported as 10.45(at 25℃) |
| color |
White |
| Water Solubility |
6.17mg/L(22.5 ºC) |
| Merck |
14,3360 |
| Stability |
Stable for 1 year from date of purchase as supplied. Solutions in DMSO or ethanol may be stored at -20°C for up to 1 month. |
| Major Application |
pharmaceutical (small molecule) |
| InChI |
1S/C21H29N3O/c1-16(2)24(17(3)4)15-13-21(20(22)25,18-10-6-5-7-11-18)19-12-8-9-14-23-19/h5-12,14,16-17H,13,15H2,1-4H3,(H2,22,25) |
| InChIKey |
UVTNFZQICZKOEM-UHFFFAOYSA-N |
| SMILES |
CC(C)N(CCC(C(N)=O)(c1ccccc1)c2ccccn2)C(C)C |
| CAS DataBase Reference |
3737-09-5(CAS DataBase Reference) |
