| Melting point |
104-108°C |
| Boiling point |
489.25°C (rough estimate) |
| Density |
1.2233 (rough estimate) |
| refractive index |
1.6800 (estimate) |
| storage temp. |
2-8°C |
| solubility |
Very soluble in water, freely soluble in ethanol (96 per cent), in methanol and in methylene chloride. |
| form |
Solid |
| color |
White |
| Water Solubility |
>=1 g/100 mL at 24 ºC |
| λmax |
262nm(lit.) |
| Merck |
14,7235 |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| InChI |
InChI=1S/C16H20N2.C4H4O4/c1-18(2)13-11-15(14-8-4-3-5-9-14)16-10-6-7-12-17-16;5-3(6)1-2-4(7)8/h3-10,12,15H,11,13H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey |
SSOXZAQUVINQSA-BTJKTKAUSA-N |
| SMILES |
C(CCN(C)C)(C1C=CC=CN=1)C1C=CC=CC=1.C(/C(=O)O)=C/C(=O)O |
| CAS DataBase Reference |
132-20-7(CAS DataBase Reference) |
| EPA Substance Registry System |
Pheniramine maleate (132-20-7) |
