| Melting point |
-38 °C (lit.) |
| Boiling point |
129-130 °C (lit.) |
| Density |
0.729 g/mL at 25 °C (lit.) |
| refractive index |
n20/D 1.42(lit.) |
| Flash point |
28 °F |
| form |
clear liquid |
| color |
Colorless to Almost colorless |
| Specific Gravity |
0.74 |
| Hydrolytic Sensitivity |
3: reacts with aqueous base |
| InChI |
1S/C8H20Si/c1-7(2,3)9-8(4,5)6/h9H2,1-6H3 |
| InChIKey |
ZLKSBZCITVUTSN-UHFFFAOYSA-N |
| SMILES |
[H][Si]([H])(C(C)(C)C)C(C)(C)C |
| CAS DataBase Reference |
30736-07-3(CAS DataBase Reference) |
| EPA Substance Registry System |
Silane, bis(1,1-dimethylethyl)- (30736-07-3) |
