Di-tert-butylsilane
- Product NameDi-tert-butylsilane
- CAS30736-07-3
- MFC8H20Si
- MW144.33
- EINECS
- MOL File30736-07-3.mol
Chemical Properties
| Melting point | -38 °C |
| Boiling point | 129 °C |
| Density | 0.73 |
| refractive index | 1.42 |
| Flash point | -2 °C |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 0.74 |
| Hydrolytic Sensitivity | 3: reacts with aqueous base |
| InChI | 1S/C8H20Si/c1-7(2,3)9-8(4,5)6/h9H2,1-6H3 |
| InChIKey | ZLKSBZCITVUTSN-UHFFFAOYSA-N |
| SMILES | [H][Si]([H])(C(C)(C)C)C(C)(C)C |
| CAS DataBase Reference | 30736-07-3(CAS DataBase Reference) |
| EPA Substance Registry System | Silane, bis(1,1-dimethylethyl)- (30736-07-3) |
Safety Information
| Hazard Codes | F |
| Risk Statements | 11 |
| Safety Statements | 16-33 |
| RIDADR | UN 1993 3/PG 1 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 2931.90.9010 |
| HazardClass | 3 |
| PackingGroup | II |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 2 |