| Melting point |
88-92 °C(lit.) |
| alpha |
-20.8 º (c=4, H2O) |
| Boiling point |
191.65°C (rough estimate) |
| Density |
1.1897 (rough estimate) |
| bulk density |
480kg/m3 |
| refractive index |
-21 ° (C=1, H2O) |
| FEMA |
3793 | D-RIBOSE |
| storage temp. |
2-8°C |
| solubility |
H2O: 0.1 g/mL, clear, colorless to light yellow |
| pka |
12.46±0.20(Predicted) |
| form |
Crystalline Powder |
| color |
White to light beige or slightly yellow |
| PH Range |
7 |
| PH |
7 (20°C, 10g/L in H2O) |
| biological source |
microbial (fermentation) |
| optical activity |
[α]21/D 19.7°, c = 4 in H2O |
| Water Solubility |
Soluble in water. Insoluble in ether. |
| Sensitive |
Hygroscopic |
| Merck |
14,8204 |
| BRN |
1723081 |
| Major Application |
flavors and fragrances |
| Cosmetics Ingredients Functions |
SKIN CONDITIONING
HUMECTANT |
| InChI |
1S/C5H10O5/c6-1-3(8)5(10)4(9)2-7/h1,3-5,7-10H,2H2/t3-,4+,5-/m0/s1 |
| InChIKey |
HMFHBZSHGGEWLO-SOOFDHNKSA-N |
| SMILES |
OC[C@@H](O)[C@@H](O)[C@@H](O)C([H])=O |
| LogP |
-1.47 |
| CAS DataBase Reference |
50-69-1(CAS DataBase Reference) |
| NIST Chemistry Reference |
D-Ribose(50-69-1) |
| EPA Substance Registry System |
D-Ribose (50-69-1) |
| CAS Number Unlabeled |
50-69-1 |
