| Melting point |
81-82 °C(lit.) |
| alpha |
20 º (c=2,water) |
| Boiling point |
191.65°C (rough estimate) |
| Density |
1.1897 (rough estimate) |
| refractive index |
20 ° (C=1, H2O) |
| storage temp. |
Inert atmosphere,Store in freezer, under -20°C |
| solubility |
Methanol (Slightly), Water (Slightly) |
| form |
Solid |
| pka |
12.22(at 25℃) |
| color |
White to Off-White |
| Water Solubility |
Soluble in water (100 mg/ml). |
| BRN |
1723084 |
| Stability |
Stable. Combustible. Incompatible with strong oxidizing agents. |
| InChI |
InChI=1S/C5H10O5/c6-1-3(8)5(10)4(9)2-7/h1,3-5,7-10H,2H2/t3-,4+,5-/m1/s1 |
| InChIKey |
PYMYPHUHKUWMLA-MROZADKFSA-N |
| SMILES |
O=C[C@H]([C@H]([C@H](CO)O)O)O |
| CAS DataBase Reference |
24259-59-4(CAS DataBase Reference) |