| Melting point |
234-236.5 °C(lit.) |
| Boiling point |
178°C |
| Density |
1.23 |
| vapor pressure |
20 hPa ( 80 °C) |
| FEMA |
2224 | CAFFEINE |
| refractive index |
1.6590 (estimate) |
| Flash point |
178°C |
| storage temp. |
2-8°C |
| solubility |
Sparingly soluble in water, freely soluble in boiling water, slightly soluble in ethanol (96 per cent). It dissolves in concentrated solutions of alkali benzoates or salicylates. |
| pka |
pKa 0.6 (Uncertain) |
| form |
Crystals or Crystalline Powder |
| color |
Silky white or white |
| Odor |
at 100.00 %. odorless |
| PH |
pH (10g/l, 25℃) : 5.5~6.5 |
| Odor Type |
odorless |
| Water Solubility |
20 g/L (20 ºC) |
| Sublimation |
178 ºC |
| Merck |
14,1636 |
| BRN |
17705 |
| Stability |
Stable. Incompatible with strong acids, strong bases, strong oxidizing agents, iodine, silver salts, tannins. Weakly light sensitive in solution. |
| Cosmetics Ingredients Functions |
FRAGRANCE SKIN CONDITIONING PERFUMING |
| InChI |
1S/C8H10N4O2/c1-10-4-9-6-5(10)7(13)12(3)8(14)11(6)2/h4H,1-3H3 |
| InChIKey |
RYYVLZVUVIJVGH-UHFFFAOYSA-N |
| SMILES |
[n]1(c2c(nc1)N(C(=O)N(C2=O)C)C)C |
| LogP |
-0.07 |
| CAS DataBase Reference |
58-08-2(CAS DataBase Reference) |
| IARC |
3 (Vol. 51) 1991 |
| NIST Chemistry Reference |
Caffeine(58-08-2) |
| EPA Substance Registry System |
Caffeine (58-08-2) |