| Melting point |
177-179 °C(lit.) |
| alpha |
-44.8° (20/D)(EtOH) |
| Boiling point |
204 °C(lit.) |
| Density |
0.990 |
| vapor density |
5.24 (vs air) |
| vapor pressure |
4 mm Hg ( 70 °C) |
| refractive index |
-44 ° (C=20, EtOH) |
| Flash point |
148 °F |
| storage temp. |
Sealed in dry,Room Temperature |
| solubility |
DMF: 30 mg/ml; DMSO: 20 mg/ml; Ethanol: 30 mg/ml; Ethanol:PBS (pH 7.2)(1:2): 0.33 mg/ml |
| form |
Adhering Crystals or Crystalline Powder |
| color |
White to yellow |
| Specific Gravity |
0.9853 (18℃) |
| Odor |
at 10.00 % in dipropylene glycol. camphor |
| Odor Type |
camphoreous |
| optical activity |
[α]20/D 43°, c = 10 in ethanol |
| explosive limit |
0.6-4.5%(V) |
| Water Solubility |
Soluble in water. (0.34 g/L) at 20°C |
| Merck |
14,1732 |
| BRN |
4291747 |
| Stability |
Stable. Incompatible with strong reducing agents, strong oxidizing agents, chlorinated solvents. Protect from direct sunlight. |
| InChI |
1S/C10H16O/c1-9(2)7-4-5-10(9,3)8(11)6-7/h7H,4-6H2,1-3H3/t7-,10+/m0/s1 |
| InChIKey |
DSSYKIVIOFKYAU-OIBJUYFYSA-N |
| SMILES |
[H][C@]12CC[C@](C)(C(=O)C1)C2(C)C |
| LogP |
2.089 (est) |
| CAS DataBase Reference |
464-48-2(CAS DataBase Reference) |
| EPA Substance Registry System |
l-Camphor (464-48-2) |
