| Melting point |
175-177 °C(lit.) |
| Boiling point |
204 °C(lit.) |
| bulk density |
800kg/m3 |
| Density |
0.992 |
| vapor density |
5.2 (vs air) |
| vapor pressure |
4 mm Hg ( 70 °C) |
| FEMA |
4513 | dl-CAMPHOR |
| refractive index |
1.5462 (estimate) |
| Flash point |
148 °F |
| storage temp. |
Store below +30°C. |
| solubility |
Soluble in acetone, ethanol, diethylether, chloroform and acetic acid. |
| form |
Solid |
| color |
White or Colorless |
| Odor |
at 10.00 % in dipropylene glycol. camphoreous |
| Odor Type |
camphoreous |
| biological source |
synthetic |
| optical activity |
[α]20/D +0.15 to -0.15°, c = 10% in ethanol |
| explosive limit |
0.6-4.5%(V) |
| Water Solubility |
0.12 g/100 mL (25 ºC) |
| Merck |
14,1732 |
| JECFA Number |
2199 |
| BRN |
1907611 |
| Henry's Law Constant |
(x 10-5 atm?m3/mol):
3.00 at 20 °C (approximate - calculated from water solubility and vapor pressure) |
| Exposure limits |
TLV-TWA 12 mg/m3 (2 ppm), STEL 18
mg/m3 (3 ppm) (ACGIH); IDLH 200 mg/m3
(NIOSH).
. |
| Stability |
Stable. Combustible. Incompatible with strong oxidizing agents, metallic salts, combustible materials, organics. |
| Major Application |
pharmaceutical (small molecule) |
| Cosmetics Ingredients Functions |
PLASTICISER
DENATURANT
FRAGRANCE |
| InChI |
1S/C10H16O/c1-9(2)7-4-5-10(9,3)8(11)6-7/h7H,4-6H2,1-3H3/t7-,10+/m1/s1 |
| InChIKey |
DSSYKIVIOFKYAU-MHPPCMCBSA-N |
| SMILES |
[H][C@](CC1=O)(CC2)C(C)(C)[C@]12C |
| LogP |
2.38 |
| CAS DataBase Reference |
76-22-2(CAS DataBase Reference) |
| NIST Chemistry Reference |
Camphor(76-22-2) |
| EPA Substance Registry System |
Camphor (76-22-2) |
