| Melting point |
137°C |
| Boiling point |
548.19°C (rough estimate) |
| Density |
1.0395 (rough estimate) |
| refractive index |
1.6010 (estimate) |
| storage temp. |
room temp |
| solubility |
Soluble in water, ethanol, chloroform; insoluble in ether, xylene |
| Colour Index |
42535 |
| form |
Crystalline Powder With Metal Luster |
| color |
Green with metal luster |
| PH Range |
0.1(YELLOW)-1.5(BLUE) |
| PH |
1-2 |
| Water Solubility |
soluble |
| λmax |
584nm |
| BRN |
8464808 |
| Stability |
Hygroscopic |
| Biological Applications |
Antimalarial agent; detecting enzyme activity,protein–protein interactions; treating diabetes,ringworm; agrochemicals; pesticides; cosmetics; wound dressing materials |
| Major Application |
Display device, photoresists, solar cells, inks, highlighters, rubber, lithium battery, petroleum products, leak detection method, decoder system, packaging materials, hair dyes, cosmetics, wound dressing materials, antitumor agent, determination of nucleic acids |
| Cosmetics Ingredients Functions |
HAIR DYEING |
| InChI |
1S/C24H27N3.ClH/c1-25-21-12-6-18(7-13-21)24(19-8-14-22(15-9-19)26(2)3)20-10-16-23(17-11-20)27(4)5;/h6-17H,1-5H3;1H |
| InChIKey |
JFTBTTPUYRGXDG-UHFFFAOYSA-N |
| SMILES |
Cl.C\N=C1/C=C\C(C=C1)=C(/c2ccc(cc2)N(C)C)c3ccc(cc3)N(C)C |
| EPA Substance Registry System |
C.I. Basic Violet 1 (8004-87-3) |