| Melting point |
158-160°C |
| Boiling point |
520.91°C (rough estimate) |
| Density |
1.0448 (rough estimate) |
| refractive index |
1.5940 (estimate) |
| storage temp. |
Refrigerator |
| solubility |
Very soluble in water; soluble in ethanol, methanol, amyl alcohol |
| form |
Solid |
| pka |
6.90(at 25℃) |
| Colour Index |
42000 |
| color |
Brown |
| PH Range |
0(green)-2(green-blue) |
| λmax |
615nm, 425nm |
| BRN |
3580148 |
| Stability |
Stable. Substances to be avoided include strong oxidizing agents. |
| Biological Applications |
Antiseptic formulation; detecting nucleic acids; early diagnosis of tuberculosis; identifying mammal genes; treating cancers,fungal diseases,pulmonary tuberculosis; medical device |
| Major Application |
Photoresists, color filter, printed circuit board, sol-gel matrix, liquid crystal displays, decoder system, inks, highlighters, herbicides, disinfectants, cosmetics, identifying mammal genes, detecting nucleic acids, mycobacterial growth, radiochemotherapy, wound dressing materials, antitumor agents, treatment of patients with pulmonary tuberculosis Malachite Green |
| Cosmetics Ingredients Functions |
HAIR DYEING |
| InChI |
1S/C23H25N2.ClH/c1-24(2)21-14-10-19(11-15-21)23(18-8-6-5-7-9-18)20-12-16-22(17-13-20)25(3)4;/h5-17H,1-4H3;1H/q+1;/p-1 |
| InChIKey |
FDZZZRQASAIRJF-UHFFFAOYSA-M |
| SMILES |
[Cl-].CN(C)c1ccc(cc1)C(\c2ccccc2)=C3\C=CC(\C=C3)=[N+](\C)C |
| LogP |
0.620 |
| CAS DataBase Reference |
569-64-2 |
| EPA Substance Registry System |
Malachite green (569-64-2) |