| Melting point |
100-102 °C |
| Boiling point |
475.4±45.0 °C(Predicted) |
| Density |
1.070±0.06 g/cm3(Predicted) |
| storage temp. |
Refrigerator, under inert atmosphere |
| solubility |
Chloroform (Slightly), DMSO (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form |
Powder |
| pka |
5.62±0.24(Predicted) |
| color |
White to light brown, light green or light blue |
| Water Solubility |
Soluble in water (<0.1 mg/ml), chloroform, benzene, ethyl ether, ethanol and toluene. |
| Sensitive |
Air Sensitive |
| λmax |
623 nm |
| BRN |
2140506 |
| Major Application |
cleaning products
cosmetics
food and beverages
personal care |
| InChI |
1S/C23H26N2/c1-24(2)21-14-10-19(11-15-21)23(18-8-6-5-7-9-18)20-12-16-22(17-13-20)25(3)4/h5-17,23H,1-4H3 |
| InChIKey |
WZKXBGJNNCGHIC-UHFFFAOYSA-N |
| SMILES |
CN(C)c1ccc(cc1)C(c2ccccc2)c3ccc(cc3)N(C)C |
| CAS DataBase Reference |
129-73-7(CAS DataBase Reference) |
| EPA Substance Registry System |
Benzenamine, 4,4'-(phenylmethylene)bis[N,N-dimethyl- (129-73-7) |
