| Melting point |
205-210 °C (dec.)(lit.) |
| storage temp. |
-20°C Freezer |
| solubility |
H2O: soluble1mg/mL |
| Colour Index |
52010 |
| form |
Powder |
| color |
Dark green |
| Water Solubility |
Soluble |
| λmax |
648–655 nm |
| ε(extinction coefficient) |
≥13000 at 241-247nm
≥36000 at 287-293nm
≥67000 at 638-644nm |
| Merck |
14,6058 |
| BRN |
3922630 |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| Major Application |
diagnostic assay manufacturing
hematology
histology |
| Biological Applications |
Antimalarial; biofuel cell; medical devices; diagnosis of amyloid accumulation related diseases,diabetes,malignant melanoma; detecting oral cancer,cells,nucleic acids; treating avian influenza virus,nail infection,oral cavity infection |
| InChI |
1S/C15H15N3S.ClH/c1-16-10-4-6-12-14(8-10)19-15-9-11(18(2)3)5-7-13(15)17-12;/h4-9H,1-3H3;1H |
| InChIKey |
DNDJEIWCTMMZBX-UHFFFAOYSA-N |
| SMILES |
C[N+](C)=C(C=C1)C=C(C1=N2)SC3=C2C=CC(NC)=C3.[Cl-] |
| CAS DataBase Reference |
531-55-5(CAS DataBase Reference) |
