| Melting point |
287 °C |
| Boiling point |
430 °C |
| Density |
1.06 g/mL at 20 °C |
| refractive index |
1.5190 (estimate) |
| Flash point |
430°C subl. |
| storage temp. |
Inert atmosphere,Room Temperature |
| solubility |
Solubility Virtually insoluble in water; moderately soluble in ethanol, soluble in benzene, toluene, Ixylene, pyridine, acetic acid |
| form |
Fine Powder |
| pka |
6.77(at 25℃) |
| Colour Index |
58000 |
| color |
Orange to orange-brown |
| PH Range |
Yellow (5.5) to red (6.8);Red (10.1) to purple (12.1) |
| PH |
5.5~7.2 |
| Water Solubility |
Soluble in hexane and chloroform. Slightly soluble in water. |
| λmax |
567nm, 609nm |
| ε(extinction coefficient) |
13000 at 227-233nm in 0.1 M NaOH at 0.01g/L 26000 at 268-274nm in 0.1 M NaOH at 0.01g/L |
| Merck |
14,251 |
| BRN |
1914037 |
| Stability |
Stable. Incompatible with strong oxidizing agents, strong bases. |
| Biological Applications |
Detecting microorganisms; treating dermatological conditions |
| Major Application |
Plasma displays, Antireflective coatings, chemical-mechanical polishing, photoreceptors, glass coatings, paints, anticorrosion coatings, thermoplastics, wood coloring, textiles, pH sensor device, detergent, hair dyes, darkening skin, cosmetics, parasiticide, antifungal agent |
| Cosmetics Ingredients Functions |
HAIR DYEING COLORANT |
| InChI |
1S/C14H8O4/c15-10-6-5-9-11(14(10)18)13(17)8-4-2-1-3-7(8)12(9)16/h1-6,15,18H |
| InChIKey |
RGCKGOZRHPZPFP-UHFFFAOYSA-N |
| SMILES |
Oc1ccc2C(=O)c3ccccc3C(=O)c2c1O |
| LogP |
2.479 (est) |
| CAS DataBase Reference |
72-48-0(CAS DataBase Reference) |
| NIST Chemistry Reference |
Alizarin(72-48-0) |
| EPA Substance Registry System |
Alizarin (72-48-0) |