| Melting point |
218-220°C |
| alpha |
D27 +12° (c = 1 in methanol) |
| Boiling point |
394.61°C (rough estimate) |
| Density |
1.0057 (rough estimate) |
| vapor pressure |
0.55 hPa ( 20 °C) |
| refractive index |
1.4434 (estimate) |
| Flash point |
87℃ |
| storage temp. |
2-8°C |
| solubility |
ethanol: soluble1mg/mL (stable at least a week at 4°C.) |
| form |
White solid |
| pka |
14.24±0.70(Predicted) |
| color |
colorless |
| biological source |
Nigrospora sphaerica |
| optical activity |
[α]27/D +12°, c = 1 in methanol(lit.) |
| Water Solubility |
Soluble in DMSO or methanol. Insoluble in water. Store solutions at -20° |
| Merck |
13,734 |
| BRN |
4689958 |
| Stability |
Stable for 2 years from date of purchase from date of purchase as supplied. Solutions in DMSO or ethanol may be stored at -20° for up to 1 month. |
| InChI |
1S/C20H34O4/c1-17(11-21)15-4-3-13-9-14-10-19(13,7-8-20(14,24)12-22)18(15,2)6-5-16(17)23/h13-16,21-24H,3-12H2,1-2H3/t13-,14+,15-,16+,17-,18-,19-,20-/m0/s1 |
| InChIKey |
NOFOAYPPHIUXJR-APNQCZIXSA-N |
| SMILES |
O[C@]1([C@H]2C[C@@]3([C@@]4([C@H]([C@@]([C@@H](CC4)O)(CO)C)CC[C@H]3C2)C)CC1)CO |
