| Melting point |
178-181 °C (lit.) |
| Boiling point |
464.1±45.0 °C(Predicted) |
| Density |
1.419±0.06 g/cm3(Predicted) |
| storage temp. |
2-8°C |
| solubility |
Practically insoluble in water, soluble in methylene chloride, sparingly soluble in acetone, slightly soluble in ethanol (96 per cent). It dissolves in dilute solutions of alkali hydroxides. |
| form |
Solid |
| pka |
7.16±0.20(Predicted) |
| color |
Yellow to Orange to Dark Yellow |
| Water Solubility |
Insoluble in water. Soluble in acetic acid, chloroform (20 mg/mL), acetone, benzene, solutions of alkali hydroxides, fixed oil. Slightly soluble in 95% ethanol, alcohol, ether, and glacial acetic acid. |
| Merck |
14,684 |
| BRN |
2054360 |
| Stability |
Stable. Combustible. Incompatible with strong oxidizing agents. |
| InChI |
1S/C14H10O3/c15-10-5-1-3-8-7-9-4-2-6-11(16)13(9)14(17)12(8)10/h1-6,15-16H,7H2 |
| InChIKey |
NUZWLKWWNNJHPT-UHFFFAOYSA-N |
| SMILES |
Oc1cccc2Cc3cccc(O)c3C(=O)c12 |
| CAS DataBase Reference |
1143-38-0(CAS DataBase Reference) |
| IARC |
3 (Vol. 13; Sup 7) 1987 |
| EPA Substance Registry System |
Dithranol (1143-38-0) |