
1143-38-0
| Name | ANTHRALIN |
| CAS | 1143-38-0 |
| EINECS(EC#) | 214-538-0 |
| Molecular Formula | C14H10O3 |
| MDL Number | MFCD00053409 |
| Molecular Weight | 226.23 |
| MOL File | 1143-38-0.mol |
Chemical Properties
| Appearance | Yellow Crystalline Solid |
| Melting point | 178-181 °C (lit.) |
| Boiling point | 464.1±45.0 °C(Predicted) |
| density | 1.419±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Practically insoluble in water, soluble in methylene chloride, sparingly soluble in acetone, slightly soluble in ethanol (96 per cent). It dissolves in dilute solutions of alkali hydroxides. |
| form | neat |
| pka | 7.16±0.20(Predicted) |
| color | Yellow to Orange to Dark Yellow |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Water Solubility | Insoluble in water. Soluble in acetic acid, chloroform (20 mg/mL), acetone, benzene, solutions of alkali hydroxides, fixed oil. Slightly soluble in 95% ethanol, alcohol, ether, and glacial acetic acid. |
| Usage | Antipsoriatic |
| Merck | 14,684 |
| BRN | 2054360 |
| InChI | 1S/C14H10O3/c15-10-5-1-3-8-7-9-4-2-6-11(16)13(9)14(17)12(8)10/h1-6,15-16H,7H2 |
| InChIKey | NUZWLKWWNNJHPT-UHFFFAOYSA-N |
| SMILES | Oc1cccc2Cc3cccc(O)c3C(=O)c12 |
| CAS DataBase Reference | 1143-38-0(CAS DataBase Reference) |
| IARC | 3 (Vol. 13; Sup 7) 1987 |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,T |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | CB8927000 |
| HS Code | 29144000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
