1. Product information
| Product Name: | 4-methylcyclohexane-1,3-diamine |
| Synonyms: | 2,4(6)-diamino-1-methylcyclohexane;HTDA;4-methylcyclohexane-1,3-diamine;1,3-Cyclohexanediamine, 4-methyl- (8CI,9CI);1-methyl-4-cyclohexanediamine;2,4-Diamino-1-methylcyclohexane;2,4-Diaminomethylcyclohexane;4-Cyclohexanediamine, 1-methyl-2 |
| CAS: | 13897-55-7 |
| MF: | C7H16N2 |
| MW: | 128.21534 |
| EINECS: | 2376669 |
| Product Categories: |
|
| Mol File: | 13897-55-7.mol |
 |
|
| 4-methylcyclohexane-1,3-diamine Chemical Properties |
| Boiling point | 227.68°C (rough estimate) |
| density | 0.9394 (rough estimate) |
| refractive index | 1.4740 (estimate) |
| pka | 10.56±0.70(Predicted) |
| InChI | InChI=1S/C7H16N2/c1-5-2-3-6(8)4-7(5)9/h5-7H,2-4,8-9H2,1H3 |
| InChIKey | QTKDDPSHNLZGRO-UHFFFAOYSA-N |
| SMILES | C1(N)CCC(C)C(N)C1 |
| EPA Substance Registry System | 1,3-Cyclohexanediamine, 4-methyl- (13897-55-7) |
2. Packaging
For powders: normal is 25kgs/Drum or bag, or larger/smaller package as request.
For liquids: normal 25kgs/drum, 180-300kgs/bucket, or IBC, determined by the nature of the product.
Or smaller package 1kg/bottle, 10kgs/bottle as request.


3. Shipping

4. Contact information
For more details, pls contact us freely.
Email address : elin@fdachem.com
Mob: 86 13613820652
WhatsApp/Skype/Wechat/LINE: 86 13613820652
