Hexamethyldisilazane CAS 999-97-3 supplier in China
Hexamethyldisilazane Quick Details
Product Name: Hexamethyldisilazane
CAS No.:999-97-3
Formula:(CH3)3SiNHSi(CH3)3
Molecular Weight:161.39
Appearance: Colorless liquid
Hexamethyldisilazane Typical Properties
| Item | Spec. |
| Density(25ºC)g/cm3 | 0.770-0.780 |
| Content of Hexamethyl disilazane(%) | 99.0 min. |
| Content of Hexamethyl disiloxane(%) | 0.5 max. |
| Content of Trimethyl silanol(%) | 0.5 max. |
| Boiling point(ºC) | 125 |
| Flash point(ºC) | 8.0 |
| Color | 20max |
| Chlorion | 50 max |
| Refractive index(n20D) | 1.408±0.002 |
China
