Tetrahydropiperine
- Product NameTetrahydropiperine
- CAS23434-88-0
- MFC17H23NO3
- MW289.37
- EINECS000-000-0
- MOL File23434-88-0.mol
Chemical Properties
| Boiling point | 261 °C(Press: 14 Torr) |
| Density | 1.156±0.06 g/cm3(Predicted) |
| solubility | DMF: 10 mg/mL; DMSO: 10 mg/mL; DMSO:PBS (pH 7.2) (1:7): 0.1 mg/mL; Ethanol: 10 mg/mL |
| pka | -0.44±0.20(Predicted) |
| form | Solid |
| color | White to off-white |
| Major Application | food and beverages pharmaceutical |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| InChIKey | APZYKUZPJCQGPP-UHFFFAOYSA-N |
| SMILES | N3(CCCCC3)C(=O)CCCCc1cc2c(cc1)OCO2 |
| LogP | 3.674 (est) |
Safety Information
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 |