Diisopropylcarbamoyl chloride
- Product NameDiisopropylcarbamoyl chloride
- CAS19009-39-3
- MFC7H14ClNO
- MW163.65
- EINECS242-743-5
- MOL File19009-39-3.mol
Chemical Properties
| Melting point | 57-59 °C (lit.) |
| Boiling point | 90-93 °C/15 mmHg (lit.) |
| Density | 1.019 |
| refractive index | 1.5580 (estimate) |
| Flash point | 82℃ |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| form | Crystalline Powder or To Low Melting Solid |
| pka | -1.97±0.70(Predicted) |
| color | Colorless to pale yellow or white to pale yellow |
| BRN | 1754834 |
| InChI | InChI=1S/C7H14ClNO/c1-5(2)9(6(3)4)7(8)10/h5-6H,1-4H3 |
| InChIKey | RSAFAYLZKCYUQW-UHFFFAOYSA-N |
| SMILES | C(Cl)(=O)N(C(C)C)C(C)C |
Safety Information
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 2924190090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |