N-[3-(Triethoxysilyl)propyl]-4,5-dihydroimidazole
- Product NameN-[3-(Triethoxysilyl)propyl]-4,5-dihydroimidazole
- CAS58068-97-6
- MFC12H26N2O3Si
- MW274.43
- EINECS261-093-3
- MOL File58068-97-6.mol
Chemical Properties
| Melting point | <0°C |
| Boiling point | 134 °C |
| Density | 1.005 g/mL at 20 °C(lit.) |
| refractive index | n |
| Flash point | >110°C |
| storage temp. | Store at room temperature |
| pka | 11.26±0.20(Predicted) |
| Specific Gravity | 1.005 |
| Appearance | Colorless to light yellow Liquid |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| BRN | 8987333 |
| InChI | InChI=1S/C12H26N2O3Si/c1-4-15-18(16-5-2,17-6-3)11-7-9-14-10-8-13-12-14/h12H,4-11H2,1-3H3 |
| InChIKey | WBUSESIMOZDSHU-UHFFFAOYSA-N |
| SMILES | C1N(CCC[Si](OCC)(OCC)OCC)CCN=1 |
| EPA Substance Registry System | 1H-Imidazole, 4,5-dihydro-1-[3-(triethoxysilyl)propyl]- (58068-97-6) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 3267 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | TSCA listed |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Oral Skin Irrit. 2 |