4-Benzyloxybenzoic acid
- Product Name4-Benzyloxybenzoic acid
- CAS1486-51-7
- MFC14H12O3
- MW228.24
- EINECS216-066-0
- MOL File1486-51-7.mol
Chemical Properties
| Melting point | 189-192 °C(lit.) |
| Boiling point | 396.3±17.0 °C(Predicted) |
| Density | 1.222 |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | very faint turbidity in Pyridine |
| form | powder to crystal |
| pka | 4.46±0.10(Predicted) |
| color | White to Almost white |
| BRN | 2111640 |
| InChI | InChI=1S/C14H12O3/c15-14(16)12-6-8-13(9-7-12)17-10-11-4-2-1-3-5-11/h1-9H,10H2,(H,15,16) |
| InChIKey | AQSCHALQLXXKKC-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(OCC2=CC=CC=C2)C=C1 |
| CAS DataBase Reference | 1486-51-7(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29189900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
