Dibutyltin bis(2,4-pentanedionate)
- Product NameDibutyltin bis(2,4-pentanedionate)
- CAS22673-19-4
- MFC18H32O4Sn
- MW431.15
- EINECS245-152-0
- MOL File22673-19-4.mol
Chemical Properties
| Melting point | 26 °C(lit.) |
| Boiling point | 150 °C(lit.) |
| Density | 1.22 g/mL at 25 °C(lit.) |
| vapor pressure | 0.038Pa at 25℃ |
| refractive index | n |
| Flash point | 130 °F |
| form | liquid |
| Specific Gravity | 1.21 |
| color | pale yellow to amber |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| Exposure limits | ACGIH: TWA 0.1 mg/m3; STEL 0.2 mg/m3 (Skin) NIOSH: IDLH 25 mg/m3; TWA 0.1 mg/m3 |
| InChI | InChI=1S/2C5H8O2.2C4H9.Sn/c2*1-4(6)3-5(2)7;2*1-3-4-2;/h2*3,6H,1-2H3;2*1,3-4H2,2H3;/q;;;;+2/p-2/b2*4-3-;;; |
| InChIKey | UVDDHYAAWVNATK-VGKOASNMSA-L |
| SMILES | [Sn](CCCC)(CCCC)(O/C(/C)=C\C(=O)C)O/C(/C)=C\C(=O)C |
| EPA Substance Registry System | Tin, dibutylbis(2,4-pentanedionato-.kappa.O2,.kappa.O4)-, (OC-6-11)- (22673-19-4) |
Safety Information
| Hazard Codes | Xn,N,T |
| Risk Statements | 10-20/21/22-36/37/38-63-68-50/53-48/25-43-34-22-61-60 |
| Safety Statements | 16-26-36-61-45-36/37/39-53 |
| RIDADR | UN 3178 4.1/PG 2 |
| WGK Germany | 2 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | II |
| Storage Class | 4.1B - Flammable solid hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Eye Dam. 1 Flam. Sol. 2 Muta. 2 Repr. 1B Skin Corr. 1C Skin Sens. 1 STOT RE 1 Oral STOT SE 1 |
