2,4-Dibromomesitylene
- Product Name2,4-Dibromomesitylene
- CAS6942-99-0
- MFC9H10Br2
- MW277.98
- EINECS230-100-1
- MOL File6942-99-0.mol
Chemical Properties
| Melting point | 61-63 °C(lit.) |
| Boiling point | 278-279 °C(lit.) |
| Density | 1.6823 (rough estimate) |
| refractive index | 1.6162 (estimate) |
| Flash point | 278-279°C |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Almost white |
| BRN | 2208246 |
| InChI | InChI=1S/C9H10Br2/c1-5-4-6(2)9(11)7(3)8(5)10/h4H,1-3H3 |
| InChIKey | CIHJFEWFZJQTFE-UHFFFAOYSA-N |
| SMILES | C1(C)=CC(C)=C(Br)C(C)=C1Br |
| CAS DataBase Reference | 6942-99-0(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 29049095 |