4-Chloro-2-(trifluoromethyl)benzoic acid
- Product Name4-Chloro-2-(trifluoromethyl)benzoic acid
- CAS142994-09-0
- MFC8H4ClF3O2
- MW224.56
- EINECS
- MOL File142994-09-0.mol
Chemical Properties
| Melting point | 108.0 to 112.0 °C |
| Boiling point | 265 °C |
| Density | 1.523 |
| Flash point | 114 °C |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Light yellow |
| InChI | InChI=1S/C8H4ClF3O2/c9-4-1-2-5(7(13)14)6(3-4)8(10,11)12/h1-3H,(H,13,14) |
| InChIKey | RKZXXMAQKMOZLK-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(Cl)C=C1C(F)(F)F |
| CAS DataBase Reference | 142994-09-0(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| RIDADR | 3265 |
| Hazard Note | Irritant |
| HS Code | 2916399090 |
