Chemical Properties
| Melting point | -20.62°C (estimate) |
| Boiling point | 73 °C/20 mmHg |
| Density | 0.87 |
| refractive index | 1.44 |
| Flash point | 65 °C |
| storage temp. | 2-8°C |
| pka | 13.28±0.20(Predicted) |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| Water Solubility | Slightly soluble in water. |
| BRN | 1740804 |
| InChI | InChI=1S/C7H12O/c1-3-5-6-7(8)4-2/h2,7-8H,3,5-6H2,1H3 |
| InChIKey | SHSFXAVQBIEYMK-UHFFFAOYSA-N |
| SMILES | C#CC(O)CCCC |
| CAS DataBase Reference | 7383-19-9(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn,N |
| Risk Statements | 22 |
| Safety Statements | 61 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 2905290000 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 Flam. Liq. 3 |
