Sorafenib N-oxide
- Product NameSorafenib N-oxide
- CAS583840-03-3
- MFC21H16ClF3N4O4
- MW480.82
- EINECS
- MOL File583840-03-3.mol
Chemical Properties
| Melting point | 220-222oC |
| Boiling point | 591.7±50.0 °C(Predicted) |
| Density | 1.45±0.1 g/cm3(Predicted) |
| storage temp. | -20°C Freezer |
| solubility | DMSO: soluble; Methanol: very slightly soluble, heated |
| form | A solid |
| pka | 12.89±0.70(Predicted) |
| color | white to off-white |
| biological source | synthetic |
| Major Application | clinical research general analytical life science and biopharma metabolomics |
| InChI | 1S/C21H16ClF3N4O4/c1-26-19(30)18-11-15(8-9-29(18)32)33-14-5-2-12(3-6-14)27-20(31)28-13-4-7-17(22)16(10-13)21(23,24)25/h2-11H,1H3,(H,26,30)(H2,27,28,31) |
| InChIKey | BQAZCCVUZDIZDC-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=[N+](C=CC(=C1)OC2=CC=C(C=C2)NC(=O)NC3=CC(=C(C=C3)Cl)C(F)(F)F)[O-] |