Di-tert-butyl 1,3-acetonedicarboxylate
- Product NameDi-tert-butyl 1,3-acetonedicarboxylate
- CAS28009-80-5
- MFC13H22O5
- MW258.31
- EINECS248-775-6
- MOL File28009-80-5.mol
Chemical Properties
| Melting point | 58-60 °C (lit.) |
| storage temp. | 2-8°C |
| solubility | methanol: soluble1g/10 mL, clear, colorless to faintly yellow |
| form | solid |
| Appearance | Off-white to light yellow Solid |
| BRN | 2272995 |
| InChI | 1S/C13H22O5/c1-12(2,3)17-10(15)7-9(14)8-11(16)18-13(4,5)6/h7-8H2,1-6H3 |
| InChIKey | KREDQIDLGFBDMQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CC(=O)CC(=O)OC(C)(C)C |
Safety Information
| WGK Germany | 3 |
| F | 21 |
| Storage Class | 11 - Combustible Solids |