2-(Tributylstannyl)furan
- Product Name2-(Tributylstannyl)furan
- CAS118486-94-5
- MFC16H30OSn
- MW357.12
- EINECS
- MOL File118486-94-5.mol
Chemical Properties
| Boiling point | 90 °C/0.1 mmHg (lit.) |
| Density | 1.134 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | liquid |
| Specific Gravity | 1.134 |
| Appearance | Colorless to light yellow Liquid |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| InChI | 1S/C4H3O.3C4H9.Sn/c1-2-4-5-3-1;3*1-3-4-2;/h1-3H;3*1,3-4H2,2H3; |
| InChIKey | SANWDQJIWZEKOD-UHFFFAOYSA-N |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1ccco1 |
| CAS DataBase Reference | 118486-94-5(CAS DataBase Reference) |
Safety Information
| Hazard Codes | T,N,Xi |
| Risk Statements | 21-25-36/38-48/23/25-50/53-36/37/38 |
| Safety Statements | 35-36/37/39-45-60-61-28-26 |
| RIDADR | UN 2788 6.1/PG 3 |
| WGK Germany | 3 |
| F | 10 |
| TSCA | No |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29321900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Acute Tox. 4 Dermal Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Repr. 1B Skin Irrit. 2 STOT RE 1 |
