Fmoc-L-4-cyanophenylalanine
- Product NameFmoc-L-4-cyanophenylalanine
- CAS173963-93-4
- MFC25H20N2O4
- MW412.44
- EINECS
- MOL File173963-93-4.mol
Chemical Properties
| Melting point | 189 °C |
| Boiling point | 531.88°C (rough estimate) |
| Density | 1.2691 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| storage temp. | 2-8°C |
| form | Solid |
| pka | 3.62±0.10(Predicted) |
| color | White to off-white |
| optical activity | Consistent with structure |
| BRN | 7500424 |
| Major Application | peptide synthesis |
| InChIKey | JOPKKUTWCGYCDA-QHCPKHFHSA-N |
| SMILES | OC(=O)[C@H](Cc1ccc(cc1)C#N)NC(=O)OCC2c3ccccc3-c4ccccc24 |
| CAS DataBase Reference | 173963-93-4(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 20/21/22 |
| Safety Statements | 36/37 |
| WGK Germany | 3 |
| HS Code | 2926 90 70 |
| HazardClass | IRRITANT |
| Storage Class | 11 - Combustible Solids |
